CAS 1003711-92-9 is the registry number for 4-iodo-3-nitropyridine, 98%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
4-iodo-3-nitropyridine (CAS 1003711-92-9) is a chemical compound with the molecular formula C5H3IN2O2 and a molecular weight of 249.99 g/mol. IUPAC name: 4-iodo-3-nitropyridine. InChIKey: WAINQAYZPSBKTE-UHFFFAOYSA-N.
| Molecular formula | C5H3IN2O2 |
|---|---|
| Molecular weight | 249.99 g/mol |
| IUPAC name | 4-iodo-3-nitropyridine |
| InChIKey | WAINQAYZPSBKTE-UHFFFAOYSA-N |
| SMILES | C1=CN=CC(=C1I)[N+](=O)[O-] |
Computed by PubChem (NCBI)