CAS 1003769-00-3 is the registry number for 2-(((5-Methylisoxazol-3-yl)methyl)thio)pyrimidine-4,6-diamine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(5-methyl-1,2-oxazol-3-yl)methylsulfanyl]pyrimidine-4,6-diamine (CAS 1003769-00-3) is a chemical compound with the molecular formula C9H11N5OS and a molecular weight of 237.28 g/mol. IUPAC name: 2-[(5-methyl-1,2-oxazol-3-yl)methylsulfanyl]pyrimidine-4,6-diamine. InChIKey: MVIIFDNLFWMQHC-UHFFFAOYSA-N.
| Molecular formula | C9H11N5OS |
|---|---|
| Molecular weight | 237.28 g/mol |
| IUPAC name | 2-[(5-methyl-1,2-oxazol-3-yl)methylsulfanyl]pyrimidine-4,6-diamine |
| InChIKey | MVIIFDNLFWMQHC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NO1)CSC2=NC(=CC(=N2)N)N |
Computed by PubChem (NCBI)