CAS 1223256-75-4 is the registry number for 6-Methyl-2-(((5-methyl-1,2,4-oxadiazol-3-yl)methyl)thio)pyrimidin-4-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-methyl-2-[(5-methyl-1,2,4-oxadiazol-3-yl)methylsulfanyl]pyrimidin-4-amine (CAS 1223256-75-4) is a chemical compound with the molecular formula C9H11N5OS and a molecular weight of 237.28 g/mol. IUPAC name: 6-methyl-2-[(5-methyl-1,2,4-oxadiazol-3-yl)methylsulfanyl]pyrimidin-4-amine. InChIKey: BVYVBPYHDASDOL-UHFFFAOYSA-N.
| Molecular formula | C9H11N5OS |
|---|---|
| Molecular weight | 237.28 g/mol |
| IUPAC name | 6-methyl-2-[(5-methyl-1,2,4-oxadiazol-3-yl)methylsulfanyl]pyrimidin-4-amine |
| InChIKey | BVYVBPYHDASDOL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=N1)SCC2=NOC(=N2)C)N |
Computed by PubChem (NCBI)