CAS 1003843-30-8 appears in our catalog under these names: N-Boc-cis-2,6-diethyl-4-piperidone, 95%, (2R,6S)–rel–tert–Butyl 2,6–diethyl–4–oxopiperidine–1–carboxylate, (2R,6S)-rel-tert-Butyl 2,6-diethyl-4-oxopiperidine-1-carboxylate 97%, (2R,6S)-rel-tert-Butyl 2,6-diethyl-4-oxopiperidine-1-carboxylate, 97%, 97%, (2R,6S)-rel-tert-Butyl 2,6-diethyl-4-oxopiperidine-1-carboxylate, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 10g, 5g, 250mg.
Tert-butyl (2S,6R)-2,6-diethyl-4-oxopiperidine-1-carboxylate (CAS 1003843-30-8) is a chemical compound with the molecular formula C14H25NO3 and a molecular weight of 255.35 g/mol. IUPAC name: tert-butyl (2S,6R)-2,6-diethyl-4-oxopiperidine-1-carboxylate. InChIKey: PRRQDRLRMZGMRO-PHIMTYICSA-N.
| Molecular formula | C14H25NO3 |
|---|---|
| Molecular weight | 255.35 g/mol |
| IUPAC name | tert-butyl (2S,6R)-2,6-diethyl-4-oxopiperidine-1-carboxylate |
| InChIKey | PRRQDRLRMZGMRO-PHIMTYICSA-N |
| SMILES | CC[C@H]1CC(=O)C[C@H](N1C(=O)OC(C)(C)C)CC |
Computed by PubChem (NCBI)