Products 374795-47-8

CAS 374795-47-8 is the registry number for 2-Oxa-9-azaspiro[5.5]undecane-9-carboxylic acid tert-butyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

Tert-butyl 2-oxa-9-azaspiro[5.5]undecane-9-carboxylate (CAS 374795-47-8) is a chemical compound with the molecular formula C14H25NO3 and a molecular weight of 255.35 g/mol. IUPAC name: tert-butyl 2-oxa-9-azaspiro[5.5]undecane-9-carboxylate. InChIKey: WTQROBXLJLQQCU-UHFFFAOYSA-N.

Identity
Molecular formulaC14H25NO3
Molecular weight255.35 g/mol
IUPAC nametert-butyl 2-oxa-9-azaspiro[5.5]undecane-9-carboxylate
InChIKeyWTQROBXLJLQQCU-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCC2(CCCOC2)CC1

Computed by PubChem (NCBI)