Products 100418-47-1
CAS 100418-47-1 appears in our catalog under these names: Methyl 4-Chloro-2,6-dinitrobenzoate, ≥95%, ≥95%, Methyl 4-chloro-2,6-dinitrobenzoate, ≥95%. Offered by: Chemat, Fluorochem. Available pack sizes: 1g.
Methyl 4-chloro-2,6-dinitrobenzoate (CAS 100418-47-1) is a chemical compound with the molecular formula C8H5ClN2O6 and a molecular weight of 260.59 g/mol. IUPAC name: methyl 4-chloro-2,6-dinitrobenzoate. InChIKey: UANMWPWYANJDGT-UHFFFAOYSA-N.
| Molecular formula | C8H5ClN2O6 |
|---|---|
| Molecular weight | 260.59 g/mol |
| IUPAC name | methyl 4-chloro-2,6-dinitrobenzoate |
| InChIKey | UANMWPWYANJDGT-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1[N+](=O)[O-])Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)