Products 2552-45-6
CAS 2552-45-6 is the registry number for Methyl 4-chloro-3,5-dinitrobenzoate. Offered by: Biosynth. Available pack sizes: 2g, 5g, 10g, 25g, 50g.
Methyl 4-chloro-3,5-dinitrobenzoate (CAS 2552-45-6) is a chemical compound with the molecular formula C8H5ClN2O6 and a molecular weight of 260.59 g/mol. IUPAC name: methyl 4-chloro-3,5-dinitrobenzoate. InChIKey: YJUFTUQWRBJBJN-UHFFFAOYSA-N.
| Molecular formula | C8H5ClN2O6 |
|---|---|
| Molecular weight | 260.59 g/mol |
| IUPAC name | methyl 4-chloro-3,5-dinitrobenzoate |
| InChIKey | YJUFTUQWRBJBJN-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C(=C1)[N+](=O)[O-])Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
Methyl 4-chloro-3,5-dinitrobenzoate, Benzoic acid, 4-chloro-3,5-dinitro-, methyl ester, Methyl 4-chloro-3,5-dinitro-benzoate, Benzoic acid,4-chloro-3,5-dinitro-, methyl ester, 4-Chloro-3,5-dinitro-benzoic acid methyl ester, NCIOpen2_002407, Metyl 4-chloro-3,5-dinitrobenzoate, methyl-4-chloro-3,5-dinitro-benzoate