CAS 1004193-84-3 is the registry number for 1-(2,3-Dichloro-phenoxymethyl)-1H-pyrazole-3-carboxylic acid hydrazide. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
1-[(2,3-dichlorophenoxy)methyl]pyrazole-3-carbohydrazide (CAS 1004193-84-3) is a chemical compound with the molecular formula C11H10Cl2N4O2 and a molecular weight of 301.13 g/mol. IUPAC name: 1-[(2,3-dichlorophenoxy)methyl]pyrazole-3-carbohydrazide. InChIKey: CJBMJTYFEMFWDF-UHFFFAOYSA-N.
| Molecular formula | C11H10Cl2N4O2 |
|---|---|
| Molecular weight | 301.13 g/mol |
| IUPAC name | 1-[(2,3-dichlorophenoxy)methyl]pyrazole-3-carbohydrazide |
| InChIKey | CJBMJTYFEMFWDF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)OCN2C=CC(=N2)C(=O)NN |
Computed by PubChem (NCBI)