CAS 956396-73-9 is the registry number for 1-((2,4-Dichlorophenoxy)methyl)-1H-pyrazole-3-carbohydrazide. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
1-[(2,4-dichlorophenoxy)methyl]pyrazole-3-carbohydrazide (CAS 956396-73-9) is a chemical compound with the molecular formula C11H10Cl2N4O2 and a molecular weight of 301.13 g/mol. IUPAC name: 1-[(2,4-dichlorophenoxy)methyl]pyrazole-3-carbohydrazide. InChIKey: CAPPFSBZHFIKIW-UHFFFAOYSA-N.
| Molecular formula | C11H10Cl2N4O2 |
|---|---|
| Molecular weight | 301.13 g/mol |
| IUPAC name | 1-[(2,4-dichlorophenoxy)methyl]pyrazole-3-carbohydrazide |
| InChIKey | CAPPFSBZHFIKIW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)OCN2C=CC(=N2)C(=O)NN |
Computed by PubChem (NCBI)