Products 1004305-98-9

CAS 1004305-98-9 is the registry number for Ethyl 2-([1,1'-biphenyl]-2-yl)-2,2-difluoroacetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Ethyl 2,2-difluoro-2-(2-phenylphenyl)acetate (CAS 1004305-98-9) is a chemical compound with the molecular formula C16H14F2O2 and a molecular weight of 276.28 g/mol. IUPAC name: ethyl 2,2-difluoro-2-(2-phenylphenyl)acetate. InChIKey: VNPRVWOOMFWSLN-UHFFFAOYSA-N.

Identity
Molecular formulaC16H14F2O2
Molecular weight276.28 g/mol
IUPAC nameethyl 2,2-difluoro-2-(2-phenylphenyl)acetate
InChIKeyVNPRVWOOMFWSLN-UHFFFAOYSA-N
SMILESCCOC(=O)C(C1=CC=CC=C1C2=CC=CC=C2)(F)F

Computed by PubChem (NCBI)