CAS 99580-00-4 appears in our catalog under these names: 2-{(Bis(4-fluorophenyl)methoxy)methyl}oxirane, 2-([Bis(4-fluorophenyl)methoxy]methyl)oxirane, 95%, 2-{(bis(4-fluorophenyl)methoxy)methyl}oxirane, 95%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 250mg, 2,5g, 5g, 10g, 1g, 100mg.
2-[bis(4-fluorophenyl)methoxymethyl]oxirane (CAS 99580-00-4) is a chemical compound with the molecular formula C16H14F2O2 and a molecular weight of 276.28 g/mol. IUPAC name: 2-[bis(4-fluorophenyl)methoxymethyl]oxirane. InChIKey: PMNKNFRBIDZMGZ-UHFFFAOYSA-N.
| Molecular formula | C16H14F2O2 |
|---|---|
| Molecular weight | 276.28 g/mol |
| IUPAC name | 2-[bis(4-fluorophenyl)methoxymethyl]oxirane |
| InChIKey | PMNKNFRBIDZMGZ-UHFFFAOYSA-N |
| SMILES | C1C(O1)COC(C2=CC=C(C=C2)F)C3=CC=C(C=C3)F |
Computed by PubChem (NCBI)