CAS 1004316-53-3 is the registry number for 4-(Azidomethyl)-2-(1-methylethyl)thiazole, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
4-(azidomethyl)-2-propan-2-yl-1,3-thiazole (CAS 1004316-53-3) is a chemical compound with the molecular formula C7H10N4S and a molecular weight of 182.25 g/mol. IUPAC name: 4-(azidomethyl)-2-propan-2-yl-1,3-thiazole. InChIKey: DHKFBPLILRQLFJ-UHFFFAOYSA-N.
| Molecular formula | C7H10N4S |
|---|---|
| Molecular weight | 182.25 g/mol |
| IUPAC name | 4-(azidomethyl)-2-propan-2-yl-1,3-thiazole |
| InChIKey | DHKFBPLILRQLFJ-UHFFFAOYSA-N |
| SMILES | CC(C)C1=NC(=CS1)CN=[N+]=[N-] |
Computed by PubChem (NCBI)