CAS 871478-39-6 is the registry number for 4-Amino-6-cyclobutyl-1,3,5-triazine-2-thiol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-amino-6-cyclobutyl-1H-1,3,5-triazine-4-thione (CAS 871478-39-6) is a chemical compound with the molecular formula C7H10N4S and a molecular weight of 182.25 g/mol. IUPAC name: 2-amino-6-cyclobutyl-1H-1,3,5-triazine-4-thione. InChIKey: SQLLSLHYUVDEFN-UHFFFAOYSA-N.
| Molecular formula | C7H10N4S |
|---|---|
| Molecular weight | 182.25 g/mol |
| IUPAC name | 2-amino-6-cyclobutyl-1H-1,3,5-triazine-4-thione |
| InChIKey | SQLLSLHYUVDEFN-UHFFFAOYSA-N |
| SMILES | C1CC(C1)C2=NC(=S)N=C(N2)N |
Computed by PubChem (NCBI)