CAS 1004451-71-1 is the registry number for 1'-Ethyl-5'-methyl-1-phenyl-1H,1'H-3,4'-bipyrazole-4-carbaldehyde. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
3-(1-ethyl-5-methylpyrazol-4-yl)-1-phenylpyrazole-4-carbaldehyde (CAS 1004451-71-1) is a chemical compound with the molecular formula C16H16N4O and a molecular weight of 280.32 g/mol. IUPAC name: 3-(1-ethyl-5-methylpyrazol-4-yl)-1-phenylpyrazole-4-carbaldehyde. InChIKey: RBFMIAMGSXNSIA-UHFFFAOYSA-N.
| Molecular formula | C16H16N4O |
|---|---|
| Molecular weight | 280.32 g/mol |
| IUPAC name | 3-(1-ethyl-5-methylpyrazol-4-yl)-1-phenylpyrazole-4-carbaldehyde |
| InChIKey | RBFMIAMGSXNSIA-UHFFFAOYSA-N |
| SMILES | CCN1C(=C(C=N1)C2=NN(C=C2C=O)C3=CC=CC=C3)C |
Computed by PubChem (NCBI)