Products 10045-73-5
CAS 10045-73-5 is the registry number for 1-(4-Methyl-2,5-dioxoimidazolidin-4-yl)urea. Offered by: TRC, Biosynth. Available pack sizes: 500mg.
(4-methyl-2,5-dioxoimidazolidin-4-yl)urea (CAS 10045-73-5) is a chemical compound with the molecular formula C5H8N4O3 and a molecular weight of 172.14 g/mol. IUPAC name: (4-methyl-2,5-dioxoimidazolidin-4-yl)urea. InChIKey: GVGVDVIUBHNQQP-UHFFFAOYSA-N.
| Molecular formula | C5H8N4O3 |
|---|---|
| Molecular weight | 172.14 g/mol |
| IUPAC name | (4-methyl-2,5-dioxoimidazolidin-4-yl)urea |
| InChIKey | GVGVDVIUBHNQQP-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)NC(=O)N1)NC(=O)N |
Computed by PubChem (NCBI)