CAS 205393-03-9 is the registry number for 1-Amino-3,5-dimethyl-1,3,5-triazinane-2,4,6-trione. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-amino-3,5-dimethyl-1,3,5-triazinane-2,4,6-trione (CAS 205393-03-9) is a chemical compound with the molecular formula C5H8N4O3 and a molecular weight of 172.14 g/mol. IUPAC name: 1-amino-3,5-dimethyl-1,3,5-triazinane-2,4,6-trione. InChIKey: HIABNKUJEJWEEN-UHFFFAOYSA-N.
| Molecular formula | C5H8N4O3 |
|---|---|
| Molecular weight | 172.14 g/mol |
| IUPAC name | 1-amino-3,5-dimethyl-1,3,5-triazinane-2,4,6-trione |
| InChIKey | HIABNKUJEJWEEN-UHFFFAOYSA-N |
| SMILES | CN1C(=O)N(C(=O)N(C1=O)N)C |
Computed by PubChem (NCBI)