CAS 1004643-40-6 is the registry number for 4-Amino-1-ethyl-N,N-dimethyl-1H-pyrazole-5-carboxamide. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
4-amino-1-ethyl-N,N-dimethylpyrazole-5-carboxamide (CAS 1004643-40-6) is a chemical compound with the molecular formula C8H14N4O and a molecular weight of 182.22 g/mol. IUPAC name: 4-amino-1-ethyl-N,N-dimethylpyrazole-5-carboxamide. InChIKey: MIFLWFMWDUUYGL-UHFFFAOYSA-N.
| Molecular formula | C8H14N4O |
|---|---|
| Molecular weight | 182.22 g/mol |
| IUPAC name | 4-amino-1-ethyl-N,N-dimethylpyrazole-5-carboxamide |
| InChIKey | MIFLWFMWDUUYGL-UHFFFAOYSA-N |
| SMILES | CCN1C(=C(C=N1)N)C(=O)N(C)C |
Computed by PubChem (NCBI)