CAS 1005100-01-5 is the registry number for N-(4-Chloro-1,1-dioxidotetrahydrothiophen-3-yl)-2-methylbutanamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(4-chloro-1,1-dioxothiolan-3-yl)-2-methylbutanamide (CAS 1005100-01-5) is a chemical compound with the molecular formula C9H16ClNO3S and a molecular weight of 253.75 g/mol. IUPAC name: N-(4-chloro-1,1-dioxothiolan-3-yl)-2-methylbutanamide. InChIKey: LPTMDSYLRLZOTE-UHFFFAOYSA-N.
| Molecular formula | C9H16ClNO3S |
|---|---|
| Molecular weight | 253.75 g/mol |
| IUPAC name | N-(4-chloro-1,1-dioxothiolan-3-yl)-2-methylbutanamide |
| InChIKey | LPTMDSYLRLZOTE-UHFFFAOYSA-N |
| SMILES | CCC(C)C(=O)NC1CS(=O)(=O)CC1Cl |
Computed by PubChem (NCBI)