Products 198342-23-3
CAS 198342-23-3 appears in our catalog under these names: Captopril hydrochloride, Captopril (hydrochloride). Offered by: TargetMol, MedChemExpress. Available pack sizes: 25mg, 50mg, 100mg, Get quote.
(2S)-1-[(2S)-2-methyl-3-sulfanylpropanoyl]pyrrolidine-2-carboxylic acid;hydrochloride (CAS 198342-23-3) is a chemical compound with the molecular formula C9H16ClNO3S and a molecular weight of 253.75 g/mol. IUPAC name: (2S)-1-[(2S)-2-methyl-3-sulfanylpropanoyl]pyrrolidine-2-carboxylic acid;hydrochloride. InChIKey: FECNGFPXMFYVNI-HHQFNNIRSA-N.
| Molecular formula | C9H16ClNO3S |
|---|---|
| Molecular weight | 253.75 g/mol |
| IUPAC name | (2S)-1-[(2S)-2-methyl-3-sulfanylpropanoyl]pyrrolidine-2-carboxylic acid;hydrochloride |
| InChIKey | FECNGFPXMFYVNI-HHQFNNIRSA-N |
| SMILES | C[C@H](CS)C(=O)N1CCC[C@H]1C(=O)O.Cl |
Computed by PubChem (NCBI)