CAS 100572-41-6 is the registry number for 4,4-Dimethyl-3,5,8-trioxabicyclo[5.1.0]octane, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 25g, 100g.
(1S,7R)-4,4-dimethyl-3,5,8-trioxabicyclo[5.1.0]octane (CAS 100572-41-6) is a chemical compound with the molecular formula C7H12O3 and a molecular weight of 144.17 g/mol. IUPAC name: (1S,7R)-4,4-dimethyl-3,5,8-trioxabicyclo[5.1.0]octane. InChIKey: GEKNCWQQNMEIMS-OLQVQODUSA-N.
| Molecular formula | C7H12O3 |
|---|---|
| Molecular weight | 144.17 g/mol |
| IUPAC name | (1S,7R)-4,4-dimethyl-3,5,8-trioxabicyclo[5.1.0]octane |
| InChIKey | GEKNCWQQNMEIMS-OLQVQODUSA-N |
| SMILES | CC1(OC[C@@H]2[C@@H](O2)CO1)C |
Computed by PubChem (NCBI)