Products 1005863-67-1
CAS 1005863-67-1 is the registry number for 1-Ethyl-N-(3-(phenylcarbamoyl)thiophen-2-yl)-1H-pyrazole-3-carboxamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-ethyl-N-[3-(phenylcarbamoyl)thiophen-2-yl]pyrazole-3-carboxamide (CAS 1005863-67-1) is a chemical compound with the molecular formula C17H16N4O2S and a molecular weight of 340.4 g/mol. IUPAC name: 1-ethyl-N-[3-(phenylcarbamoyl)thiophen-2-yl]pyrazole-3-carboxamide. InChIKey: OIBBEACFJKZTRS-UHFFFAOYSA-N.
| Molecular formula | C17H16N4O2S |
|---|---|
| Molecular weight | 340.4 g/mol |
| IUPAC name | 1-ethyl-N-[3-(phenylcarbamoyl)thiophen-2-yl]pyrazole-3-carboxamide |
| InChIKey | OIBBEACFJKZTRS-UHFFFAOYSA-N |
| SMILES | CCN1C=CC(=N1)C(=O)NC2=C(C=CS2)C(=O)NC3=CC=CC=C3 |
Computed by PubChem (NCBI)