Products 362502-77-0
CAS 362502-77-0 is the registry number for ((2-indol-3-ylethyl)amino)((4-nitrophenyl)amino)methane-1-thione. Offered by: Biosynth. Available pack sizes: 250mg.
1-[2-(1H-indol-3-yl)ethyl]-3-(4-nitrophenyl)thiourea (CAS 362502-77-0) is a chemical compound with the molecular formula C17H16N4O2S and a molecular weight of 340.4 g/mol. IUPAC name: 1-[2-(1H-indol-3-yl)ethyl]-3-(4-nitrophenyl)thiourea. InChIKey: SMDPWIHXDHLAHD-UHFFFAOYSA-N.
| Molecular formula | C17H16N4O2S |
|---|---|
| Molecular weight | 340.4 g/mol |
| IUPAC name | 1-[2-(1H-indol-3-yl)ethyl]-3-(4-nitrophenyl)thiourea |
| InChIKey | SMDPWIHXDHLAHD-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)CCNC(=S)NC3=CC=C(C=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)