Products 1006037-59-7
CAS 1006037-59-7 appears in our catalog under these names: Lorcaserin Impurity 7, (S)-Lorcaserin HCl, (S)-Lorcaserin Hydrochloride. Offered by: Hubei YoungXin, Chemat Brand, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, on request, 250mg.
(5S)-7-chloro-5-methyl-2,3,4,5-tetrahydro-1H-3-benzazepine;hydrochloride (CAS 1006037-59-7) is a chemical compound with the molecular formula C11H15Cl2N and a molecular weight of 232.15 g/mol. IUPAC name: (5S)-7-chloro-5-methyl-2,3,4,5-tetrahydro-1H-3-benzazepine;hydrochloride. InChIKey: ITIHHRMYZPNGRC-DDWIOCJRSA-N.
| Molecular formula | C11H15Cl2N |
|---|---|
| Molecular weight | 232.15 g/mol |
| IUPAC name | (5S)-7-chloro-5-methyl-2,3,4,5-tetrahydro-1H-3-benzazepine;hydrochloride |
| InChIKey | ITIHHRMYZPNGRC-DDWIOCJRSA-N |
| SMILES | C[C@@H]1CNCCC2=C1C=C(C=C2)Cl.Cl |
Computed by PubChem (NCBI)