CAS 1006334-36-6 is the registry number for 1-(Difluoromethyl)-3-methyl-1H-pyrazole-5-carbohydrazide. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
2-(difluoromethyl)-5-methylpyrazole-3-carbohydrazide (CAS 1006334-36-6) is a chemical compound with the molecular formula C6H8F2N4O and a molecular weight of 190.15 g/mol. IUPAC name: 2-(difluoromethyl)-5-methylpyrazole-3-carbohydrazide. InChIKey: WAWNAJRFWGYXSI-UHFFFAOYSA-N.
| Molecular formula | C6H8F2N4O |
|---|---|
| Molecular weight | 190.15 g/mol |
| IUPAC name | 2-(difluoromethyl)-5-methylpyrazole-3-carbohydrazide |
| InChIKey | WAWNAJRFWGYXSI-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=C1)C(=O)NN)C(F)F |
Computed by PubChem (NCBI)