CAS 1699683-25-4 appears in our catalog under these names: 4-Amino-1-(2,2-difluoroethyl)-1H-pyrazole-3-carboxamide, 95%, 4-Amino-1-(2,2-difluoroethyl)-1H-pyrazole-3-carboxamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
4-amino-1-(2,2-difluoroethyl)pyrazole-3-carboxamide (CAS 1699683-25-4) is a chemical compound with the molecular formula C6H8F2N4O and a molecular weight of 190.15 g/mol. IUPAC name: 4-amino-1-(2,2-difluoroethyl)pyrazole-3-carboxamide. InChIKey: WBWDKDUFPGEVTG-UHFFFAOYSA-N.
| Molecular formula | C6H8F2N4O |
|---|---|
| Molecular weight | 190.15 g/mol |
| IUPAC name | 4-amino-1-(2,2-difluoroethyl)pyrazole-3-carboxamide |
| InChIKey | WBWDKDUFPGEVTG-UHFFFAOYSA-N |
| SMILES | C1=C(C(=NN1CC(F)F)C(=O)N)N |
Computed by PubChem (NCBI)