Products 1343793-69-0
CAS 1343793-69-0 is the registry number for 1-(3,5-Dimethyl-1-(2,2,2-trifluoroethyl)-1H-pyrazol-4-yl)ethan-1-amine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-[3,5-dimethyl-1-(2,2,2-trifluoroethyl)pyrazol-4-yl]ethanamine (CAS 1343793-69-0) is a chemical compound with the molecular formula C9H14F3N3 and a molecular weight of 221.22 g/mol. IUPAC name: 1-[3,5-dimethyl-1-(2,2,2-trifluoroethyl)pyrazol-4-yl]ethanamine. InChIKey: RMJPREAIXSMPOO-UHFFFAOYSA-N.
| Molecular formula | C9H14F3N3 |
|---|---|
| Molecular weight | 221.22 g/mol |
| IUPAC name | 1-[3,5-dimethyl-1-(2,2,2-trifluoroethyl)pyrazol-4-yl]ethanamine |
| InChIKey | RMJPREAIXSMPOO-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1CC(F)(F)F)C)C(C)N |
Computed by PubChem (NCBI)