CAS 100638-20-8 is the registry number for 7-Fluoro-2H-1,4-benzothiazin-3(4H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-fluoro-4H-1,4-benzothiazin-3-one (CAS 100638-20-8) is a chemical compound with the molecular formula C8H6FNOS and a molecular weight of 183.20 g/mol. IUPAC name: 7-fluoro-4H-1,4-benzothiazin-3-one. InChIKey: ZRSCIBYAOVOFIG-UHFFFAOYSA-N.
| Molecular formula | C8H6FNOS |
|---|---|
| Molecular weight | 183.20 g/mol |
| IUPAC name | 7-fluoro-4H-1,4-benzothiazin-3-one |
| InChIKey | ZRSCIBYAOVOFIG-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(S1)C=C(C=C2)F |
Computed by PubChem (NCBI)