CAS 398-64-1 is the registry number for 6–Fluoro–2H–benzo(b)(1,4)thiazin–3(4H)–one. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.
6-fluoro-4H-1,4-benzothiazin-3-one (CAS 398-64-1) is a chemical compound with the molecular formula C8H6FNOS and a molecular weight of 183.20 g/mol. IUPAC name: 6-fluoro-4H-1,4-benzothiazin-3-one. InChIKey: OLFXXFMYHLPQQT-UHFFFAOYSA-N.
| Molecular formula | C8H6FNOS |
|---|---|
| Molecular weight | 183.20 g/mol |
| IUPAC name | 6-fluoro-4H-1,4-benzothiazin-3-one |
| InChIKey | OLFXXFMYHLPQQT-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(S1)C=CC(=C2)F |
Computed by PubChem (NCBI)