CAS 100638-26-4 appears in our catalog under these names: 3-Chloro-n-(3-fluorophenyl)propanamide, 95%, 3-Chloro-N-(3-fluorophenyl)propanamide 95%, 3-Chloro-N-(3-fluorophenyl)propanamide, 95%, 95%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 500mg.
3-chloro-N-(3-fluorophenyl)propanamide (CAS 100638-26-4) is a chemical compound with the molecular formula C9H9ClFNO and a molecular weight of 201.62 g/mol. IUPAC name: 3-chloro-N-(3-fluorophenyl)propanamide. InChIKey: NXEZFWIYWQILFE-UHFFFAOYSA-N.
| Molecular formula | C9H9ClFNO |
|---|---|
| Molecular weight | 201.62 g/mol |
| IUPAC name | 3-chloro-N-(3-fluorophenyl)propanamide |
| InChIKey | NXEZFWIYWQILFE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)NC(=O)CCCl |
Computed by PubChem (NCBI)