Products 1006442-84-7

CAS 1006442-84-7 is the registry number for 1-(4-Fluoro-2-nitrophenyl)-1h-pyrazole-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

1-(4-fluoro-2-nitrophenyl)pyrazole-3-carboxylic acid (CAS 1006442-84-7) is a chemical compound with the molecular formula C10H6FN3O4 and a molecular weight of 251.17 g/mol. IUPAC name: 1-(4-fluoro-2-nitrophenyl)pyrazole-3-carboxylic acid. InChIKey: LQULXIZZTARLFO-UHFFFAOYSA-N.

Identity
Molecular formulaC10H6FN3O4
Molecular weight251.17 g/mol
IUPAC name1-(4-fluoro-2-nitrophenyl)pyrazole-3-carboxylic acid
InChIKeyLQULXIZZTARLFO-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1F)[N+](=O)[O-])N2C=CC(=N2)C(=O)O

Computed by PubChem (NCBI)