CAS 1186663-21-7 appears in our catalog under these names: 4-Fluoro-5-(1h-pyrazol-1-yl)-2-nitrobenzoic acid, 95%, 4–Fluoro–5–(1–pyrazolyl)–2–nitrobenzoic Acid, 4-Fluoro-5-(1-pyrazolyl)-2-nitrobenzoic Acid, >97%, >97%. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 1g, 250mg, 100mg.
4-fluoro-2-nitro-5-pyrazol-1-ylbenzoic acid (CAS 1186663-21-7) is a chemical compound with the molecular formula C10H6FN3O4 and a molecular weight of 251.17 g/mol. IUPAC name: 4-fluoro-2-nitro-5-pyrazol-1-ylbenzoic acid. InChIKey: XYFAPGQLTCVZOK-UHFFFAOYSA-N.
| Molecular formula | C10H6FN3O4 |
|---|---|
| Molecular weight | 251.17 g/mol |
| IUPAC name | 4-fluoro-2-nitro-5-pyrazol-1-ylbenzoic acid |
| InChIKey | XYFAPGQLTCVZOK-UHFFFAOYSA-N |
| SMILES | C1=CN(N=C1)C2=C(C=C(C(=C2)C(=O)O)[N+](=O)[O-])F |
Computed by PubChem (NCBI)