Products 1006447-63-7
CAS 1006447-63-7 is the registry number for 3-(4-Chloro-3,5-dimethyl-1H-pyrazol-1-yl)-1-(4-chlorophenyl)propan-1-one. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
3-(4-chloro-3,5-dimethylpyrazol-1-yl)-1-(4-chlorophenyl)propan-1-one (CAS 1006447-63-7) is a chemical compound with the molecular formula C14H14Cl2N2O and a molecular weight of 297.2 g/mol. IUPAC name: 3-(4-chloro-3,5-dimethylpyrazol-1-yl)-1-(4-chlorophenyl)propan-1-one. InChIKey: XXXCFLVYMCRBDG-UHFFFAOYSA-N.
| Molecular formula | C14H14Cl2N2O |
|---|---|
| Molecular weight | 297.2 g/mol |
| IUPAC name | 3-(4-chloro-3,5-dimethylpyrazol-1-yl)-1-(4-chlorophenyl)propan-1-one |
| InChIKey | XXXCFLVYMCRBDG-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1CCC(=O)C2=CC=C(C=C2)Cl)C)Cl |
Computed by PubChem (NCBI)