CAS 1006455-35-1 appears in our catalog under these names: 4-([4-Chloro-3-(trifluoromethyl)-1h-pyrazol-1-yl]methyl)benzoic acid, 95%, 4-{(4-Chloro-3-(trifluoromethyl)-1H-pyrazol-1-yl)methyl}benzoic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g, 0,5g.
4-[[4-chloro-3-(trifluoromethyl)pyrazol-1-yl]methyl]benzoic acid (CAS 1006455-35-1) is a chemical compound with the molecular formula C12H8ClF3N2O2 and a molecular weight of 304.65 g/mol. IUPAC name: 4-[[4-chloro-3-(trifluoromethyl)pyrazol-1-yl]methyl]benzoic acid. InChIKey: NBNKTCZKXRYYLX-UHFFFAOYSA-N.
| Molecular formula | C12H8ClF3N2O2 |
|---|---|
| Molecular weight | 304.65 g/mol |
| IUPAC name | 4-[[4-chloro-3-(trifluoromethyl)pyrazol-1-yl]methyl]benzoic acid |
| InChIKey | NBNKTCZKXRYYLX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN2C=C(C(=N2)C(F)(F)F)Cl)C(=O)O |
Computed by PubChem (NCBI)