CAS 1375472-56-2 appears in our catalog under these names: 2-Chloro-6-{(3-(trifluoromethoxy)phenyl)methoxy}pyrazine, 2-Chloro-6-{(3-(trifluoromethoxy)phenyl)methoxy}pyrazine, 98%. Offered by: Biosynth, AmBeed. Available pack sizes: 50mg, 0,5g, 1g.
2-chloro-6-[[3-(trifluoromethoxy)phenyl]methoxy]pyrazine (CAS 1375472-56-2) is a chemical compound with the molecular formula C12H8ClF3N2O2 and a molecular weight of 304.65 g/mol. IUPAC name: 2-chloro-6-[[3-(trifluoromethoxy)phenyl]methoxy]pyrazine. InChIKey: DJZYDXMNCZURPV-UHFFFAOYSA-N.
| Molecular formula | C12H8ClF3N2O2 |
|---|---|
| Molecular weight | 304.65 g/mol |
| IUPAC name | 2-chloro-6-[[3-(trifluoromethoxy)phenyl]methoxy]pyrazine |
| InChIKey | DJZYDXMNCZURPV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OC(F)(F)F)COC2=CN=CC(=N2)Cl |
Computed by PubChem (NCBI)