CAS 1006457-69-7 is the registry number for 5-((4-Nitro-1H-pyrazol-1-yl)methyl)thiophene-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-[(4-nitropyrazol-1-yl)methyl]thiophene-2-carboxylic acid (CAS 1006457-69-7) is a chemical compound with the molecular formula C9H7N3O4S and a molecular weight of 253.24 g/mol. IUPAC name: 5-[(4-nitropyrazol-1-yl)methyl]thiophene-2-carboxylic acid. InChIKey: XKMAISRBBHCPRY-UHFFFAOYSA-N.
| Molecular formula | C9H7N3O4S |
|---|---|
| Molecular weight | 253.24 g/mol |
| IUPAC name | 5-[(4-nitropyrazol-1-yl)methyl]thiophene-2-carboxylic acid |
| InChIKey | XKMAISRBBHCPRY-UHFFFAOYSA-N |
| SMILES | C1=C(SC(=C1)C(=O)O)CN2C=C(C=N2)[N+](=O)[O-] |
Computed by PubChem (NCBI)