Products 1006457-74-4

CAS 1006457-74-4 is the registry number for 5-((3-Nitro-1H-pyrazol-1-yl)methyl)thiophene-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

5-[(3-nitropyrazol-1-yl)methyl]thiophene-2-carboxylic acid (CAS 1006457-74-4) is a chemical compound with the molecular formula C9H7N3O4S and a molecular weight of 253.24 g/mol. IUPAC name: 5-[(3-nitropyrazol-1-yl)methyl]thiophene-2-carboxylic acid. InChIKey: YMBYQKLENUMWGB-UHFFFAOYSA-N.

Identity
Molecular formulaC9H7N3O4S
Molecular weight253.24 g/mol
IUPAC name5-[(3-nitropyrazol-1-yl)methyl]thiophene-2-carboxylic acid
InChIKeyYMBYQKLENUMWGB-UHFFFAOYSA-N
SMILESC1=CN(N=C1[N+](=O)[O-])CC2=CC=C(S2)C(=O)O

Computed by PubChem (NCBI)