CAS 1006538-98-2 appears in our catalog under these names: 4-Bromo-1-{(3-(trifluoromethyl)phenyl)methyl}-1H-pyrazole, 95%, 4-Bromo-1-{(3-(trifluoromethyl)phenyl)methyl}-1H-pyrazole. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
4-bromo-1-[[3-(trifluoromethyl)phenyl]methyl]pyrazole (CAS 1006538-98-2) is a chemical compound with the molecular formula C11H8BrF3N2 and a molecular weight of 305.09 g/mol. IUPAC name: 4-bromo-1-[[3-(trifluoromethyl)phenyl]methyl]pyrazole. InChIKey: DWOQMKZOPXCXIW-UHFFFAOYSA-N.
| Molecular formula | C11H8BrF3N2 |
|---|---|
| Molecular weight | 305.09 g/mol |
| IUPAC name | 4-bromo-1-[[3-(trifluoromethyl)phenyl]methyl]pyrazole |
| InChIKey | DWOQMKZOPXCXIW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)CN2C=C(C=N2)Br |
Computed by PubChem (NCBI)