CAS 1057383-73-9 appears in our catalog under these names: 5-Bromo-1-(4-(trifluoromethyl)benzyl)-1H-Pyrazole, 5-Bromo-1-((4-(trifluoromethyl)phenyl)methyl)-1H-pyrazole. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 500mg.
5-bromo-1-[[4-(trifluoromethyl)phenyl]methyl]pyrazole (CAS 1057383-73-9) is a chemical compound with the molecular formula C11H8BrF3N2 and a molecular weight of 305.09 g/mol. IUPAC name: 5-bromo-1-[[4-(trifluoromethyl)phenyl]methyl]pyrazole. InChIKey: SASAROUJIYZKTB-UHFFFAOYSA-N.
| Molecular formula | C11H8BrF3N2 |
|---|---|
| Molecular weight | 305.09 g/mol |
| IUPAC name | 5-bromo-1-[[4-(trifluoromethyl)phenyl]methyl]pyrazole |
| InChIKey | SASAROUJIYZKTB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN2C(=CC=N2)Br)C(F)(F)F |
Computed by PubChem (NCBI)