CAS 1006682-81-0 is the registry number for N1-Methyl-N1-((1-methyl-1H-pyrazol-4-yl)methyl)benzene-1,4-diamine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-N-methyl-4-N-[(1-methylpyrazol-4-yl)methyl]benzene-1,4-diamine (CAS 1006682-81-0) is a chemical compound with the molecular formula C12H16N4 and a molecular weight of 216.28 g/mol. IUPAC name: 4-N-methyl-4-N-[(1-methylpyrazol-4-yl)methyl]benzene-1,4-diamine. InChIKey: WAMLJZGQJTUBMC-UHFFFAOYSA-N.
| Molecular formula | C12H16N4 |
|---|---|
| Molecular weight | 216.28 g/mol |
| IUPAC name | 4-N-methyl-4-N-[(1-methylpyrazol-4-yl)methyl]benzene-1,4-diamine |
| InChIKey | WAMLJZGQJTUBMC-UHFFFAOYSA-N |
| SMILES | CN1C=C(C=N1)CN(C)C2=CC=C(C=C2)N |
Computed by PubChem (NCBI)