CAS 1006693-48-6 is the registry number for 1,9-Dichlorophenanthrene. Offered by: TRC. Available pack sizes: 500mg.
1,9-dichlorophenanthrene (CAS 1006693-48-6) is a chemical compound with the molecular formula C14H8Cl2 and a molecular weight of 247.1 g/mol. IUPAC name: 1,9-dichlorophenanthrene. InChIKey: PZCCKIQXAAUPPL-UHFFFAOYSA-N.
| Molecular formula | C14H8Cl2 |
|---|---|
| Molecular weight | 247.1 g/mol |
| IUPAC name | 1,9-dichlorophenanthrene |
| InChIKey | PZCCKIQXAAUPPL-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(C=C2Cl)C(=CC=C3)Cl |
Computed by PubChem (NCBI)