CAS 605-48-1 appears in our catalog under these names: 9,10-Dichloroanthracene, 98%, 9,10-Dichloroanthracene, >95% (HPLC), 9,10-Dichloroanthracene, 9,10–Dichloroanthracene, 9,10-Dichloroanthracene, 97% . Offered by: Combi-blocks, TRC, Dr. Ehrenstorfer, GLPBio, Thermo Scientific (Alfa Aesar). Available pack sizes: 1g, 25g, 5g, 100mg, 10mg, 50mg, 10g, 100g.
9,10-dichloroanthracene (CAS 605-48-1) is a chemical compound with the molecular formula C14H8Cl2 and a molecular weight of 247.1 g/mol. IUPAC name: 9,10-dichloroanthracene. InChIKey: FKDIWXZNKAZCBY-UHFFFAOYSA-N.
| Molecular formula | C14H8Cl2 |
|---|---|
| Molecular weight | 247.1 g/mol |
| IUPAC name | 9,10-dichloroanthracene |
| InChIKey | FKDIWXZNKAZCBY-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C3C=CC=CC3=C2Cl)Cl |
Computed by PubChem (NCBI)