CAS 1006699-32-6 is the registry number for (2E)-3-(3-(6-(Hexahydro-4-methyl-1H-1,4-diazepin-1-yl)-2-pyrazinyl)phenyl)-2-propenoic Acid. Offered by: TRC. Available pack sizes: 100mg.
(E)-3-[3-[6-(4-methyl-1,4-diazepan-1-yl)pyrazin-2-yl]phenyl]prop-2-enoic acid (CAS 1006699-32-6) is a chemical compound with the molecular formula C19H22N4O2 and a molecular weight of 338.4 g/mol. IUPAC name: (E)-3-[3-[6-(4-methyl-1,4-diazepan-1-yl)pyrazin-2-yl]phenyl]prop-2-enoic acid. InChIKey: DTBFDAJNODVUMF-VOTSOKGWSA-N.
| Molecular formula | C19H22N4O2 |
|---|---|
| Molecular weight | 338.4 g/mol |
| IUPAC name | (E)-3-[3-[6-(4-methyl-1,4-diazepan-1-yl)pyrazin-2-yl]phenyl]prop-2-enoic acid |
| InChIKey | DTBFDAJNODVUMF-VOTSOKGWSA-N |
| SMILES | CN1CCCN(CC1)C2=NC(=CN=C2)C3=CC=CC(=C3)/C=C/C(=O)O |
Computed by PubChem (NCBI)