CAS 1006962-65-7 is the registry number for [3-(4-Nitro-1h-pyrazol-1-yl)propyl]amine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
3-(4-nitropyrazol-1-yl)propan-1-amine (CAS 1006962-65-7) is a chemical compound with the molecular formula C6H10N4O2 and a molecular weight of 170.17 g/mol. IUPAC name: 3-(4-nitropyrazol-1-yl)propan-1-amine. InChIKey: ZRJCSYHOBOKAOR-UHFFFAOYSA-N.
| Molecular formula | C6H10N4O2 |
|---|---|
| Molecular weight | 170.17 g/mol |
| IUPAC name | 3-(4-nitropyrazol-1-yl)propan-1-amine |
| InChIKey | ZRJCSYHOBOKAOR-UHFFFAOYSA-N |
| SMILES | C1=C(C=NN1CCCN)[N+](=O)[O-] |
Computed by PubChem (NCBI)