CAS 1185760-32-0 is the registry number for 1-(tert-Butyl)-3-nitro-1h-1,2,4-triazole, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
1-tert-butyl-3-nitro-1,2,4-triazole (CAS 1185760-32-0) is a chemical compound with the molecular formula C6H10N4O2 and a molecular weight of 170.17 g/mol. IUPAC name: 1-tert-butyl-3-nitro-1,2,4-triazole. InChIKey: BPLNOVCERPNHDL-UHFFFAOYSA-N.
| Molecular formula | C6H10N4O2 |
|---|---|
| Molecular weight | 170.17 g/mol |
| IUPAC name | 1-tert-butyl-3-nitro-1,2,4-triazole |
| InChIKey | BPLNOVCERPNHDL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)N1C=NC(=N1)[N+](=O)[O-] |
Computed by PubChem (NCBI)