CAS 1006993-51-6 is the registry number for 4-Chloro-1-ethyl-3-nitro-1h-pyrazole, 95%. Offered by: AmBeed. Available pack sizes: 10g.
4-chloro-1-ethyl-3-nitropyrazole (CAS 1006993-51-6) is a chemical compound with the molecular formula C5H6ClN3O2 and a molecular weight of 175.57 g/mol. IUPAC name: 4-chloro-1-ethyl-3-nitropyrazole. InChIKey: SBVDGHFCPWPZQO-UHFFFAOYSA-N.
| Molecular formula | C5H6ClN3O2 |
|---|---|
| Molecular weight | 175.57 g/mol |
| IUPAC name | 4-chloro-1-ethyl-3-nitropyrazole |
| InChIKey | SBVDGHFCPWPZQO-UHFFFAOYSA-N |
| SMILES | CCN1C=C(C(=N1)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)