Products 1220040-21-0
CAS 1220040-21-0 appears in our catalog under these names: 5-Nitro-pyridin-3-ylamine hydrochloride, 95%, 5-Nitropyridin-3-amine hydrochloride, 98%, 5-Nitropyridin-3-amine hydrochloride, 5-Nitro-pyridin-3-ylamine hydrochloride, 98%, 98%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg, 2,5g.
5-nitropyridin-3-amine;hydrochloride (CAS 1220040-21-0) is a chemical compound with the molecular formula C5H6ClN3O2 and a molecular weight of 175.57 g/mol. IUPAC name: 5-nitropyridin-3-amine;hydrochloride. InChIKey: ONHDBLKSXWWPMB-UHFFFAOYSA-N.
| Molecular formula | C5H6ClN3O2 |
|---|---|
| Molecular weight | 175.57 g/mol |
| IUPAC name | 5-nitropyridin-3-amine;hydrochloride |
| InChIKey | ONHDBLKSXWWPMB-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC=C1[N+](=O)[O-])N.Cl |
Computed by PubChem (NCBI)