Products 100704-06-1
CAS 100704-06-1 is the registry number for 2-chloro-3-methylpyridin-1-ium-1-olate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-chloro-3-methyl-1-oxidopyridin-1-ium;hydrochloride (CAS 100704-06-1) is a chemical compound with the molecular formula C6H7Cl2NO and a molecular weight of 180.03 g/mol. IUPAC name: 2-chloro-3-methyl-1-oxidopyridin-1-ium;hydrochloride. InChIKey: FYKQMHHUPQCHNO-UHFFFAOYSA-N.
| Molecular formula | C6H7Cl2NO |
|---|---|
| Molecular weight | 180.03 g/mol |
| IUPAC name | 2-chloro-3-methyl-1-oxidopyridin-1-ium;hydrochloride |
| InChIKey | FYKQMHHUPQCHNO-UHFFFAOYSA-N |
| SMILES | CC1=C([N+](=CC=C1)[O-])Cl.Cl |
Computed by PubChem (NCBI)