Products 5100-15-2

CAS 5100-15-2 is the registry number for 6-Chloro-3,4-dihydro-1(2h)-pyridinecarbonyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 25g.

Structural formula: {0} (CAS {1})

6-chloro-3,4-dihydro-2H-pyridine-1-carbonyl chloride (CAS 5100-15-2) is a chemical compound with the molecular formula C6H7Cl2NO and a molecular weight of 180.03 g/mol. IUPAC name: 6-chloro-3,4-dihydro-2H-pyridine-1-carbonyl chloride. InChIKey: VVOVQRRLTYPIST-UHFFFAOYSA-N.

Identity
Molecular formulaC6H7Cl2NO
Molecular weight180.03 g/mol
IUPAC name6-chloro-3,4-dihydro-2H-pyridine-1-carbonyl chloride
InChIKeyVVOVQRRLTYPIST-UHFFFAOYSA-N
SMILESC1CC=C(N(C1)C(=O)Cl)Cl

Computed by PubChem (NCBI)