Products 1007089-03-3

CAS 1007089-03-3 is the registry number for 5-(2,5-Dichlorophenyl)thiophene-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

5-(2,5-dichlorophenyl)thiophene-2-carboxylic acid (CAS 1007089-03-3) is a chemical compound with the molecular formula C11H6Cl2O2S and a molecular weight of 273.1 g/mol. IUPAC name: 5-(2,5-dichlorophenyl)thiophene-2-carboxylic acid. InChIKey: UOZVUWWGSRUGCR-UHFFFAOYSA-N.

Identity
Molecular formulaC11H6Cl2O2S
Molecular weight273.1 g/mol
IUPAC name5-(2,5-dichlorophenyl)thiophene-2-carboxylic acid
InChIKeyUOZVUWWGSRUGCR-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1Cl)C2=CC=C(S2)C(=O)O)Cl

Computed by PubChem (NCBI)