CAS 1007089-03-3 is the registry number for 5-(2,5-Dichlorophenyl)thiophene-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
5-(2,5-dichlorophenyl)thiophene-2-carboxylic acid (CAS 1007089-03-3) is a chemical compound with the molecular formula C11H6Cl2O2S and a molecular weight of 273.1 g/mol. IUPAC name: 5-(2,5-dichlorophenyl)thiophene-2-carboxylic acid. InChIKey: UOZVUWWGSRUGCR-UHFFFAOYSA-N.
| Molecular formula | C11H6Cl2O2S |
|---|---|
| Molecular weight | 273.1 g/mol |
| IUPAC name | 5-(2,5-dichlorophenyl)thiophene-2-carboxylic acid |
| InChIKey | UOZVUWWGSRUGCR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C2=CC=C(S2)C(=O)O)Cl |
Computed by PubChem (NCBI)