CAS 338793-86-5 appears in our catalog under these names: 5-(3,4-Dichlorophenyl)thiophene-2-carboxylic Acid, 5-(3,4-Dichlorophenyl)thiophene-2-carboxylic acid, 95%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 2,5g, 250mg, 1g, 5g.
5-(3,4-dichlorophenyl)thiophene-2-carboxylic acid (CAS 338793-86-5) is a chemical compound with the molecular formula C11H6Cl2O2S and a molecular weight of 273.1 g/mol. IUPAC name: 5-(3,4-dichlorophenyl)thiophene-2-carboxylic acid. InChIKey: DTTQYQNEMXQJDH-UHFFFAOYSA-N.
| Molecular formula | C11H6Cl2O2S |
|---|---|
| Molecular weight | 273.1 g/mol |
| IUPAC name | 5-(3,4-dichlorophenyl)thiophene-2-carboxylic acid |
| InChIKey | DTTQYQNEMXQJDH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=CC=C(S2)C(=O)O)Cl)Cl |
Computed by PubChem (NCBI)